C29H30N2O6 — CID 11752418
2-[[4-(2-indol-1-ylethoxy)phenyl]methyl-(4-methoxyphenoxy)carbonylamino]butanoic acid (PubChem CID 11752418) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is 2-[[4-(2-indol-1-ylethoxy)phenyl]methyl-(4-methoxyphenoxy)carbonylamino]butanoic acid.
| Compound Name | 2-[[4-(2-indol-1-ylethoxy)phenyl]methyl-(4-methoxyphenoxy)carbonylamino]butanoic acid |
|---|---|
| PubChem CID | 11752418 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 2-[[4-(2-indol-1-ylethoxy)phenyl]methyl-(4-methoxyphenoxy)carbonylamino]butanoic acid |
| SMILES | CCC(C(=O)O)N(Cc1ccc(OCCn2ccc3ccccc32)cc1)C(=O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H30N2O6/c1-3-26(28(32)33)31(29(34)37-25-14-12-23(35-2)13-15-25)20-21-8-10-24(11-9-21)36-19-18-30-17-16-22-6-4-5-7-27(22)30/h4-17,26H,3,18-20H2,1-2H3,(H,32,33) |
| InChIKey | HSMLICHVHBRHQM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |