C21H25NO3 — CID 10427312
(2S)-2-ethoxy-3-[4-(2-indol-1-ylethoxy)phenyl]propan-1-ol (PubChem CID 10427312) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-(2-indol-1-ylethoxy)phenyl]propan-1-ol.
| Compound Name | (2S)-2-ethoxy-3-[4-(2-indol-1-ylethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 10427312 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-(2-indol-1-ylethoxy)phenyl]propan-1-ol |
| SMILES | CCO[C@H](CO)Cc1ccc(OCCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-2-24-20(16-23)15-17-7-9-19(10-8-17)25-14-13-22-12-11-18-5-3-4-6-21(18)22/h3-12,20,23H,2,13-16H2,1H3/t20-/m0/s1 |
| InChIKey | XEUKCMPVPUVZEW-FQEVSTJZSA-N |
| XLogP | 3.66 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |