C18H20NO5- — CID 22168739
2-ethoxy-3-[4-[2-(2-formylpyrrol-1-yl)ethoxy]phenyl]propanoate (PubChem CID 22168739) has the molecular formula C18H20NO5- and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-(2-formylpyrrol-1-yl)ethoxy]phenyl]propanoate.
| Compound Name | 2-ethoxy-3-[4-[2-(2-formylpyrrol-1-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22168739 |
| Molecular Formula | C18H20NO5- |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-ethoxy-3-[4-[2-(2-formylpyrrol-1-yl)ethoxy]phenyl]propanoate |
| SMILES | CCOC(Cc1ccc(OCCn2cccc2C=O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C18H21NO5/c1-2-23-17(18(21)22)12-14-5-7-16(8-6-14)24-11-10-19-9-3-4-15(19)13-20/h3-9,13,17H,2,10-12H2,1H3,(H,21,22)/p-1 |
| InChIKey | QPWMIWSKNIKXSC-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 80.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|