C23H30N2O4 — CID 129457750
(2R)-1-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl-methylamino]-3-indol-1-ylpropan-2-ol (PubChem CID 129457750) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is (2R)-1-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl-methylamino]-3-indol-1-ylpropan-2-ol.
| Compound Name | (2R)-1-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl-methylamino]-3-indol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 129457750 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (2R)-1-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl-methylamino]-3-indol-1-ylpropan-2-ol |
| SMILES | CN(Cc1ccc(OCCOCCO)cc1)C[C@@H](O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C23H30N2O4/c1-24(16-19-6-8-22(9-7-19)29-15-14-28-13-12-26)17-21(27)18-25-11-10-20-4-2-3-5-23(20)25/h2-11,21,26-27H,12-18H2,1H3/t21-/m1/s1 |
| InChIKey | QSQQVXPOCYTQFO-OAQYLSRUSA-N |
| XLogP | 2.52 |
| TPSA | 67.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|