C23H33NO5 — CID 129457349
(2S)-1-(2,4-dimethylphenoxy)-3-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl-methylamino]propan-2-ol (PubChem CID 129457349) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is (2S)-1-(2,4-dimethylphenoxy)-3-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl-methylamino]propan-2-ol.
| Compound Name | (2S)-1-(2,4-dimethylphenoxy)-3-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 129457349 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (2S)-1-(2,4-dimethylphenoxy)-3-[[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]methyl-methylamino]propan-2-ol |
| SMILES | Cc1ccc(OC[C@@H](O)CN(C)Cc2ccc(OCCOCCO)cc2)c(C)c1 |
| InChI | InChI=1S/C23H33NO5/c1-18-4-9-23(19(2)14-18)29-17-21(26)16-24(3)15-20-5-7-22(8-6-20)28-13-12-27-11-10-25/h4-9,14,21,25-26H,10-13,15-17H2,1-3H3/t21-/m0/s1 |
| InChIKey | PCTPEIPDPAEVML-NRFANRHFSA-N |
| XLogP | 2.56 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|