C23H30N2O3 — CID 132765696
1-(2,3-dimethylindol-1-yl)-3-[[4-(2-hydroxyethoxy)phenyl]methyl-methylamino]propan-2-ol (PubChem CID 132765696) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-(2,3-dimethylindol-1-yl)-3-[[4-(2-hydroxyethoxy)phenyl]methyl-methylamino]propan-2-ol.
| Compound Name | 1-(2,3-dimethylindol-1-yl)-3-[[4-(2-hydroxyethoxy)phenyl]methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 132765696 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-(2,3-dimethylindol-1-yl)-3-[[4-(2-hydroxyethoxy)phenyl]methyl-methylamino]propan-2-ol |
| SMILES | Cc1c(C)n(CC(O)CN(C)Cc2ccc(OCCO)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H30N2O3/c1-17-18(2)25(23-7-5-4-6-22(17)23)16-20(27)15-24(3)14-19-8-10-21(11-9-19)28-13-12-26/h4-11,20,26-27H,12-16H2,1-3H3 |
| InChIKey | PPLUPUXDPZKAPG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|