C27H35N3O3 — CID 132767291
1-[2-[4-[[[3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]-methylamino]methyl]phenoxy]ethyl]pyrrolidin-2-one (PubChem CID 132767291) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[2-[4-[[[3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]-methylamino]methyl]phenoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[4-[[[3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]-methylamino]methyl]phenoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 132767291 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-[2-[4-[[[3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]-methylamino]methyl]phenoxy]ethyl]pyrrolidin-2-one |
| SMILES | Cc1c(C)n(CC(O)CN(C)Cc2ccc(OCCN3CCCC3=O)cc2)c2ccccc12 |
| InChI | InChI=1S/C27H35N3O3/c1-20-21(2)30(26-8-5-4-7-25(20)26)19-23(31)18-28(3)17-22-10-12-24(13-11-22)33-16-15-29-14-6-9-27(29)32/h4-5,7-8,10-13,23,31H,6,9,14-19H2,1-3H3 |
| InChIKey | MLLVJLLOYGPLJY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|