C26H36N2O5 — CID 129457094
1-[3-[4-[[[(2R)-3-(2-ethoxyphenoxy)-2-hydroxypropyl]-methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one (PubChem CID 129457094) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is 1-[3-[4-[[[(2R)-3-(2-ethoxyphenoxy)-2-hydroxypropyl]-methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[[[(2R)-3-(2-ethoxyphenoxy)-2-hydroxypropyl]-methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129457094 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 1-[3-[4-[[[(2R)-3-(2-ethoxyphenoxy)-2-hydroxypropyl]-methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one |
| SMILES | CCOc1ccccc1OC[C@H](O)CN(C)Cc1ccc(OCCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C26H36N2O5/c1-3-31-24-8-4-5-9-25(24)33-20-22(29)19-27(2)18-21-11-13-23(14-12-21)32-17-7-16-28-15-6-10-26(28)30/h4-5,8-9,11-14,22,29H,3,6-7,10,15-20H2,1-2H3/t22-/m1/s1 |
| InChIKey | ODNHSEGYRFOMSZ-JOCHJYFZSA-N |
| XLogP | 3.35 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|