C25H35N3O4 — CID 25461165
1-[2-[[3-[(2R)-3-[benzyl(methyl)amino]-2-hydroxypropoxy]-4-methoxyphenyl]methylamino]ethyl]pyrrolidin-2-one (PubChem CID 25461165) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 1-[2-[[3-[(2R)-3-[benzyl(methyl)amino]-2-hydroxypropoxy]-4-methoxyphenyl]methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[[3-[(2R)-3-[benzyl(methyl)amino]-2-hydroxypropoxy]-4-methoxyphenyl]methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 25461165 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 1-[2-[[3-[(2R)-3-[benzyl(methyl)amino]-2-hydroxypropoxy]-4-methoxyphenyl]methylamino]ethyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CNCCN2CCCC2=O)cc1OC[C@H](O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H35N3O4/c1-27(17-20-7-4-3-5-8-20)18-22(29)19-32-24-15-21(10-11-23(24)31-2)16-26-12-14-28-13-6-9-25(28)30/h3-5,7-8,10-11,15,22,26,29H,6,9,12-14,16-19H2,1-2H3/t22-/m1/s1 |
| InChIKey | MCUQVJAYHBNGPH-JOCHJYFZSA-N |
| XLogP | 2.28 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|