C25H34N4O3 — CID 45243107
1-[benzyl(methyl)amino]-3-[2-methoxy-5-[[2-(2-methylimidazol-1-yl)ethylamino]methyl]phenoxy]propan-2-ol (PubChem CID 45243107) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[[2-(2-methylimidazol-1-yl)ethylamino]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[[2-(2-methylimidazol-1-yl)ethylamino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45243107 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[[2-(2-methylimidazol-1-yl)ethylamino]methyl]phenoxy]propan-2-ol |
| SMILES | COc1ccc(CNCCn2ccnc2C)cc1OCC(O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H34N4O3/c1-20-27-12-14-29(20)13-11-26-16-22-9-10-24(31-3)25(15-22)32-19-23(30)18-28(2)17-21-7-5-4-6-8-21/h4-10,12,14-15,23,26,30H,11,13,16-19H2,1-3H3 |
| InChIKey | SJYKJHBPDGFLRI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|