C26H39N3O3 — CID 45215278
1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(3-pyrrolidin-1-ylpropylamino)methyl]phenoxy]propan-2-ol (PubChem CID 45215278) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(3-pyrrolidin-1-ylpropylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(3-pyrrolidin-1-ylpropylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45215278 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(3-pyrrolidin-1-ylpropylamino)methyl]phenoxy]propan-2-ol |
| SMILES | COc1ccc(CNCCCN2CCCC2)cc1OCC(O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C26H39N3O3/c1-28(19-22-9-4-3-5-10-22)20-24(30)21-32-26-17-23(11-12-25(26)31-2)18-27-13-8-16-29-14-6-7-15-29/h3-5,9-12,17,24,27,30H,6-8,13-16,18-21H2,1-2H3 |
| InChIKey | NSBBUMHSJFXOQA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|