C23H34N2O3S — CID 26408578
(2S)-1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(3-methylsulfanylpropylamino)methyl]phenoxy]propan-2-ol (PubChem CID 26408578) has the molecular formula C23H34N2O3S and a molecular weight of 418.60 g/mol. Its IUPAC name is (2S)-1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(3-methylsulfanylpropylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(3-methylsulfanylpropylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 26408578 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (2S)-1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(3-methylsulfanylpropylamino)methyl]phenoxy]propan-2-ol |
| SMILES | COc1ccc(CNCCCSC)cc1OC[C@@H](O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H34N2O3S/c1-25(16-19-8-5-4-6-9-19)17-21(26)18-28-23-14-20(10-11-22(23)27-2)15-24-12-7-13-29-3/h4-6,8-11,14,21,24,26H,7,12-13,15-18H2,1-3H3/t21-/m0/s1 |
| InChIKey | PGVTXEWUVSMGAD-NRFANRHFSA-N |
| XLogP | 3.41 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|