C27H34N2O4 — CID 45242008
1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(2-phenoxyethylamino)methyl]phenoxy]propan-2-ol (PubChem CID 45242008) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(2-phenoxyethylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(2-phenoxyethylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45242008 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1-[benzyl(methyl)amino]-3-[2-methoxy-5-[(2-phenoxyethylamino)methyl]phenoxy]propan-2-ol |
| SMILES | COc1ccc(CNCCOc2ccccc2)cc1OCC(O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C27H34N2O4/c1-29(19-22-9-5-3-6-10-22)20-24(30)21-33-27-17-23(13-14-26(27)31-2)18-28-15-16-32-25-11-7-4-8-12-25/h3-14,17,24,28,30H,15-16,18-21H2,1-2H3 |
| InChIKey | BCUJOAWPXSAMMX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|