C21H29NO5 — CID 132777879
1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]-3-phenoxypropan-2-ol (PubChem CID 132777879) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 132777879 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]-3-phenoxypropan-2-ol |
| SMILES | COCCOc1cc(CN(C)CC(O)COc2ccccc2)ccc1OC |
| InChI | InChI=1S/C21H29NO5/c1-22(15-18(23)16-27-19-7-5-4-6-8-19)14-17-9-10-20(25-3)21(13-17)26-12-11-24-2/h4-10,13,18,23H,11-12,14-16H2,1-3H3 |
| InChIKey | MBUOBDRCXHCINE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|