C24H36N2O5 — CID 132778982
1-[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methyl-methylamino]-3-(4-methoxyphenoxy)propan-2-ol (PubChem CID 132778982) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is 1-[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methyl-methylamino]-3-(4-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methyl-methylamino]-3-(4-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 132778982 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 1-[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methyl-methylamino]-3-(4-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccc(OCC(O)CN(C)Cc2ccc(OCCCN(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H36N2O5/c1-25(2)13-6-14-30-23-12-7-19(15-24(23)29-5)16-26(3)17-20(27)18-31-22-10-8-21(28-4)9-11-22/h7-12,15,20,27H,6,13-14,16-18H2,1-5H3 |
| InChIKey | BOLUCVIPBCXJHF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|