C25H35N3O3 — CID 132778798
1-[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methyl-methylamino]-3-indol-1-ylpropan-2-ol (PubChem CID 132778798) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methyl-methylamino]-3-indol-1-ylpropan-2-ol.
| Compound Name | 1-[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methyl-methylamino]-3-indol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 132778798 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 1-[[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]methyl-methylamino]-3-indol-1-ylpropan-2-ol |
| SMILES | COc1cc(CN(C)CC(O)Cn2ccc3ccccc32)ccc1OCCCN(C)C |
| InChI | InChI=1S/C25H35N3O3/c1-26(2)13-7-15-31-24-11-10-20(16-25(24)30-4)17-27(3)18-22(29)19-28-14-12-21-8-5-6-9-23(21)28/h5-6,8-12,14,16,22,29H,7,13,15,17-19H2,1-4H3 |
| InChIKey | BFOPYVMCOUUUFB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|