C26H33N3O3 — CID 129458533
1-[3-[4-[[[(2R)-2-hydroxy-3-indol-1-ylpropyl]-methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one (PubChem CID 129458533) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[3-[4-[[[(2R)-2-hydroxy-3-indol-1-ylpropyl]-methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[[[(2R)-2-hydroxy-3-indol-1-ylpropyl]-methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129458533 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[3-[4-[[[(2R)-2-hydroxy-3-indol-1-ylpropyl]-methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one |
| SMILES | CN(Cc1ccc(OCCCN2CCCC2=O)cc1)C[C@@H](O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C26H33N3O3/c1-27(19-23(30)20-29-16-13-22-6-2-3-7-25(22)29)18-21-9-11-24(12-10-21)32-17-5-15-28-14-4-8-26(28)31/h2-3,6-7,9-13,16,23,30H,4-5,8,14-15,17-20H2,1H3/t23-/m1/s1 |
| InChIKey | UFXJRZRMRKJFRY-HSZRJFAPSA-N |
| XLogP | 3.53 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|