C29H37N3O4S — CID 132780782
1-[[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]methyl-(2-hydroxyethyl)amino]-3-phenothiazin-10-ylpropan-2-ol (PubChem CID 132780782) has the molecular formula C29H37N3O4S and a molecular weight of 523.70 g/mol. Its IUPAC name is 1-[[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]methyl-(2-hydroxyethyl)amino]-3-phenothiazin-10-ylpropan-2-ol.
| Compound Name | 1-[[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]methyl-(2-hydroxyethyl)amino]-3-phenothiazin-10-ylpropan-2-ol |
|---|---|
| PubChem CID | 132780782 |
| Molecular Formula | C29H37N3O4S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 1-[[4-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]methyl-(2-hydroxyethyl)amino]-3-phenothiazin-10-ylpropan-2-ol |
| SMILES | COc1cc(CN(CCO)CC(O)CN2c3ccccc3Sc3ccccc32)ccc1OCCN(C)C |
| InChI | InChI=1S/C29H37N3O4S/c1-30(2)15-17-36-26-13-12-22(18-27(26)35-3)19-31(14-16-33)20-23(34)21-32-24-8-4-6-10-28(24)37-29-11-7-5-9-25(29)32/h4-13,18,23,33-34H,14-17,19-21H2,1-3H3 |
| InChIKey | ZLDFNMYIRFDRTQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|