C29H36N2O5 — CID 129454400
(2S)-1-carbazol-9-yl-3-[2-methoxyethyl-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]amino]propan-2-ol (PubChem CID 129454400) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is (2S)-1-carbazol-9-yl-3-[2-methoxyethyl-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]amino]propan-2-ol.
| Compound Name | (2S)-1-carbazol-9-yl-3-[2-methoxyethyl-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 129454400 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | (2S)-1-carbazol-9-yl-3-[2-methoxyethyl-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]amino]propan-2-ol |
| SMILES | COCCOc1cc(CN(CCOC)C[C@H](O)Cn2c3ccccc3c3ccccc32)ccc1OC |
| InChI | InChI=1S/C29H36N2O5/c1-33-15-14-30(19-22-12-13-28(35-3)29(18-22)36-17-16-34-2)20-23(32)21-31-26-10-6-4-8-24(26)25-9-5-7-11-27(25)31/h4-13,18,23,32H,14-17,19-21H2,1-3H3/t23-/m0/s1 |
| InChIKey | DROFEBGLNNSBJV-QHCPKHFHSA-N |
| XLogP | 4.34 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|