C18H31NO3 — CID 46006960
1-[(3,4-dimethoxyphenyl)methyl-(3-methylbutyl)amino]butan-2-ol (PubChem CID 46006960) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl-(3-methylbutyl)amino]butan-2-ol.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl-(3-methylbutyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 46006960 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl-(3-methylbutyl)amino]butan-2-ol |
| SMILES | CCC(O)CN(CCC(C)C)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H31NO3/c1-6-16(20)13-19(10-9-14(2)3)12-15-7-8-17(21-4)18(11-15)22-5/h7-8,11,14,16,20H,6,9-10,12-13H2,1-5H3 |
| InChIKey | BWPPXPDGNITMLS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |