C25H29NO4 — CID 46006860
1-[benzyl-[(3,4-dimethoxyphenyl)methyl]amino]-3-phenoxypropan-2-ol (PubChem CID 46006860) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-[benzyl-[(3,4-dimethoxyphenyl)methyl]amino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[benzyl-[(3,4-dimethoxyphenyl)methyl]amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 46006860 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-[benzyl-[(3,4-dimethoxyphenyl)methyl]amino]-3-phenoxypropan-2-ol |
| SMILES | COc1ccc(CN(Cc2ccccc2)CC(O)COc2ccccc2)cc1OC |
| InChI | InChI=1S/C25H29NO4/c1-28-24-14-13-21(15-25(24)29-2)17-26(16-20-9-5-3-6-10-20)18-22(27)19-30-23-11-7-4-8-12-23/h3-15,22,27H,16-19H2,1-2H3 |
| InChIKey | QSMPTBAAZGPIAG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |