C31H39N3O5S — CID 132781120
1-[2-hydroxyethyl-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methyl]amino]-3-phenothiazin-10-ylpropan-2-ol (PubChem CID 132781120) has the molecular formula C31H39N3O5S and a molecular weight of 565.74 g/mol. Its IUPAC name is 1-[2-hydroxyethyl-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methyl]amino]-3-phenothiazin-10-ylpropan-2-ol.
| Compound Name | 1-[2-hydroxyethyl-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methyl]amino]-3-phenothiazin-10-ylpropan-2-ol |
|---|---|
| PubChem CID | 132781120 |
| Molecular Formula | C31H39N3O5S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 1-[2-hydroxyethyl-[[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]methyl]amino]-3-phenothiazin-10-ylpropan-2-ol |
| SMILES | COc1cc(CN(CCO)CC(O)CN2c3ccccc3Sc3ccccc32)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C31H39N3O5S/c1-37-29-20-24(10-11-28(29)39-19-15-32-13-17-38-18-14-32)21-33(12-16-35)22-25(36)23-34-26-6-2-4-8-30(26)40-31-9-5-3-7-27(31)34/h2-11,20,25,35-36H,12-19,21-23H2,1H3 |
| InChIKey | BBEPATHKDXPSOU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|