C21H34N2O4 — CID 93160809
(2S)-1-[(3,4-dimethoxyphenyl)methyl-(2-morpholin-4-ylethyl)amino]hex-5-en-2-ol (PubChem CID 93160809) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is (2S)-1-[(3,4-dimethoxyphenyl)methyl-(2-morpholin-4-ylethyl)amino]hex-5-en-2-ol.
| Compound Name | (2S)-1-[(3,4-dimethoxyphenyl)methyl-(2-morpholin-4-ylethyl)amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93160809 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | (2S)-1-[(3,4-dimethoxyphenyl)methyl-(2-morpholin-4-ylethyl)amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN(CCN1CCOCC1)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H34N2O4/c1-4-5-6-19(24)17-23(10-9-22-11-13-27-14-12-22)16-18-7-8-20(25-2)21(15-18)26-3/h4,7-8,15,19,24H,1,5-6,9-14,16-17H2,2-3H3/t19-/m0/s1 |
| InChIKey | BZFWUPUHQMVRPH-IBGZPJMESA-N |
| XLogP | 2.17 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|