C19H32N2O4 — CID 45242296
1-(diethylamino)-3-[2-methoxy-4-(morpholin-4-ylmethyl)phenoxy]propan-2-ol (PubChem CID 45242296) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-(diethylamino)-3-[2-methoxy-4-(morpholin-4-ylmethyl)phenoxy]propan-2-ol.
| Compound Name | 1-(diethylamino)-3-[2-methoxy-4-(morpholin-4-ylmethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45242296 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-(diethylamino)-3-[2-methoxy-4-(morpholin-4-ylmethyl)phenoxy]propan-2-ol |
| SMILES | CCN(CC)CC(O)COc1ccc(CN2CCOCC2)cc1OC |
| InChI | InChI=1S/C19H32N2O4/c1-4-20(5-2)14-17(22)15-25-18-7-6-16(12-19(18)23-3)13-21-8-10-24-11-9-21/h6-7,12,17,22H,4-5,8-11,13-15H2,1-3H3 |
| InChIKey | UZYWFHAEFYSJNC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |