C20H34N4O4 — CID 72874731
4-[[3-[3-(diethylamino)-2-hydroxypropoxy]-4-methoxyphenyl]methyl]piperazine-1-carboxamide (PubChem CID 72874731) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-[[3-[3-(diethylamino)-2-hydroxypropoxy]-4-methoxyphenyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-[[3-[3-(diethylamino)-2-hydroxypropoxy]-4-methoxyphenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 72874731 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 4-[[3-[3-(diethylamino)-2-hydroxypropoxy]-4-methoxyphenyl]methyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)CC(O)COc1cc(CN2CCN(C(N)=O)CC2)ccc1OC |
| InChI | InChI=1S/C20H34N4O4/c1-4-22(5-2)14-17(25)15-28-19-12-16(6-7-18(19)27-3)13-23-8-10-24(11-9-23)20(21)26/h6-7,12,17,25H,4-5,8-11,13-15H2,1-3H3,(H2,21,26) |
| InChIKey | HMGOBRHESYDIMW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |