C21H36N2O4 — CID 45240353
1-(diethylamino)-3-[2-methoxy-5-[(4-methoxypiperidin-1-yl)methyl]phenoxy]propan-2-ol (PubChem CID 45240353) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-(diethylamino)-3-[2-methoxy-5-[(4-methoxypiperidin-1-yl)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-(diethylamino)-3-[2-methoxy-5-[(4-methoxypiperidin-1-yl)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45240353 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 1-(diethylamino)-3-[2-methoxy-5-[(4-methoxypiperidin-1-yl)methyl]phenoxy]propan-2-ol |
| SMILES | CCN(CC)CC(O)COc1cc(CN2CCC(OC)CC2)ccc1OC |
| InChI | InChI=1S/C21H36N2O4/c1-5-22(6-2)15-18(24)16-27-21-13-17(7-8-20(21)26-4)14-23-11-9-19(25-3)10-12-23/h7-8,13,18-19,24H,5-6,9-12,14-16H2,1-4H3 |
| InChIKey | HDVNKQFZLBXZCA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |