C21H35NO5 — CID 155984690
1-cyclohexyloxy-3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]propan-2-ol (PubChem CID 155984690) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-cyclohexyloxy-3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]propan-2-ol.
| Compound Name | 1-cyclohexyloxy-3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 155984690 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 1-cyclohexyloxy-3-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl-methylamino]propan-2-ol |
| SMILES | COCCOc1cc(CN(C)CC(O)COC2CCCCC2)ccc1OC |
| InChI | InChI=1S/C21H35NO5/c1-22(15-18(23)16-27-19-7-5-4-6-8-19)14-17-9-10-20(25-3)21(13-17)26-12-11-24-2/h9-10,13,18-19,23H,4-8,11-12,14-16H2,1-3H3 |
| InChIKey | HJBIKJFSRFNXRK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|