C23H38N2O4 — CID 155984691
1-cyclohexyloxy-3-[methyl-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]amino]propan-2-ol (PubChem CID 155984691) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-cyclohexyloxy-3-[methyl-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]amino]propan-2-ol.
| Compound Name | 1-cyclohexyloxy-3-[methyl-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 155984691 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 1-cyclohexyloxy-3-[methyl-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]amino]propan-2-ol |
| SMILES | CN(Cc1ccc(OCCN2CCOCC2)cc1)CC(O)COC1CCCCC1 |
| InChI | InChI=1S/C23H38N2O4/c1-24(18-21(26)19-29-22-5-3-2-4-6-22)17-20-7-9-23(10-8-20)28-16-13-25-11-14-27-15-12-25/h7-10,21-22,26H,2-6,11-19H2,1H3 |
| InChIKey | SWCBPTTZDBTUHT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |