C20H33NO4 — CID 132777480
1-cyclohexyloxy-3-[[4-(3-hydroxypropoxy)phenyl]methyl-methylamino]propan-2-ol (PubChem CID 132777480) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-cyclohexyloxy-3-[[4-(3-hydroxypropoxy)phenyl]methyl-methylamino]propan-2-ol.
| Compound Name | 1-cyclohexyloxy-3-[[4-(3-hydroxypropoxy)phenyl]methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 132777480 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 1-cyclohexyloxy-3-[[4-(3-hydroxypropoxy)phenyl]methyl-methylamino]propan-2-ol |
| SMILES | CN(Cc1ccc(OCCCO)cc1)CC(O)COC1CCCCC1 |
| InChI | InChI=1S/C20H33NO4/c1-21(15-18(23)16-25-19-6-3-2-4-7-19)14-17-8-10-20(11-9-17)24-13-5-12-22/h8-11,18-19,22-23H,2-7,12-16H2,1H3 |
| InChIKey | ATYFMAPYKHMJII-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|