C23H28F3N3O3 — CID 132779489
1-[[4-(2-ethoxyethoxy)phenyl]methyl-methylamino]-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol (PubChem CID 132779489) has the molecular formula C23H28F3N3O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 1-[[4-(2-ethoxyethoxy)phenyl]methyl-methylamino]-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol.
| Compound Name | 1-[[4-(2-ethoxyethoxy)phenyl]methyl-methylamino]-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 132779489 |
| Molecular Formula | C23H28F3N3O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 1-[[4-(2-ethoxyethoxy)phenyl]methyl-methylamino]-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol |
| SMILES | CCOCCOc1ccc(CN(C)CC(O)Cn2c(C(F)(F)F)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H28F3N3O3/c1-3-31-12-13-32-19-10-8-17(9-11-19)14-28(2)15-18(30)16-29-21-7-5-4-6-20(21)27-22(29)23(24,25)26/h4-11,18,30H,3,12-16H2,1-2H3 |
| InChIKey | OPXWJAJWKRJISG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|