C17H12F6N2O2 — CID 97312272
(1R)-1-[4-(trifluoromethoxy)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanol (PubChem CID 97312272) has the molecular formula C17H12F6N2O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is (1R)-1-[4-(trifluoromethoxy)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanol.
| Compound Name | (1R)-1-[4-(trifluoromethoxy)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 97312272 |
| Molecular Formula | C17H12F6N2O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (1R)-1-[4-(trifluoromethoxy)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanol |
| SMILES | O[C@@H](Cn1c(C(F)(F)F)nc2ccccc21)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F6N2O2/c18-16(19,20)15-24-12-3-1-2-4-13(12)25(15)9-14(26)10-5-7-11(8-6-10)27-17(21,22)23/h1-8,14,26H,9H2/t14-/m0/s1 |
| InChIKey | CXSISJJNERJDPP-AWEZNQCLSA-N |
| XLogP | 4.69 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |