C20H22F3N3 — CID 71635073
N-benzyl-N-methyl-2-[2-(trifluoromethyl)benzimidazol-1-yl]butan-1-amine (PubChem CID 71635073) has the molecular formula C20H22F3N3 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[2-(trifluoromethyl)benzimidazol-1-yl]butan-1-amine.
| Compound Name | N-benzyl-N-methyl-2-[2-(trifluoromethyl)benzimidazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 71635073 |
| Molecular Formula | C20H22F3N3 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-benzyl-N-methyl-2-[2-(trifluoromethyl)benzimidazol-1-yl]butan-1-amine |
| SMILES | CCC(CN(C)Cc1ccccc1)n1c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C20H22F3N3/c1-3-16(14-25(2)13-15-9-5-4-6-10-15)26-18-12-8-7-11-17(18)24-19(26)20(21,22)23/h4-12,16H,3,13-14H2,1-2H3 |
| InChIKey | GFONJQXIRKMDBG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |