C22H23F3N4O2 — CID 46284789
N-[2-[benzyl(methyl)amino]ethyl]-2-[2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]propanamide (PubChem CID 46284789) has the molecular formula C22H23F3N4O2 and a molecular weight of 432.45 g/mol. Its IUPAC name is N-[2-[benzyl(methyl)amino]ethyl]-2-[2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]propanamide.
| Compound Name | N-[2-[benzyl(methyl)amino]ethyl]-2-[2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]propanamide |
|---|---|
| PubChem CID | 46284789 |
| Molecular Formula | C22H23F3N4O2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[2-[benzyl(methyl)amino]ethyl]-2-[2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]propanamide |
| SMILES | CC(C(=O)NCCN(C)Cc1ccccc1)n1c(=O)c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C22H23F3N4O2/c1-15(20(30)26-12-13-28(2)14-16-8-4-3-5-9-16)29-18-11-7-6-10-17(18)27-19(21(29)31)22(23,24)25/h3-11,15H,12-14H2,1-2H3,(H,26,30) |
| InChIKey | CEKJLOUPJABVCR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |