C23H25F3N4O2 — CID 92865195
(2S)-N-[[4-(dimethylamino)phenyl]methyl]-2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]propanamide (PubChem CID 92865195) has the molecular formula C23H25F3N4O2 and a molecular weight of 446.47 g/mol. Its IUPAC name is (2S)-N-[[4-(dimethylamino)phenyl]methyl]-2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]propanamide.
| Compound Name | (2S)-N-[[4-(dimethylamino)phenyl]methyl]-2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]propanamide |
|---|---|
| PubChem CID | 92865195 |
| Molecular Formula | C23H25F3N4O2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2S)-N-[[4-(dimethylamino)phenyl]methyl]-2-[6,7-dimethyl-2-oxo-3-(trifluoromethyl)quinoxalin-1-yl]propanamide |
| SMILES | Cc1cc2nc(C(F)(F)F)c(=O)n([C@@H](C)C(=O)NCc3ccc(N(C)C)cc3)c2cc1C |
| InChI | InChI=1S/C23H25F3N4O2/c1-13-10-18-19(11-14(13)2)30(22(32)20(28-18)23(24,25)26)15(3)21(31)27-12-16-6-8-17(9-7-16)29(4)5/h6-11,15H,12H2,1-5H3,(H,27,31)/t15-/m0/s1 |
| InChIKey | QQIPAMMVIYNEGC-HNNXBMFYSA-N |
| XLogP | 3.98 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|