C19H18F3N3O — CID 3715694
N-[(4-methylphenyl)methyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]propanamide (PubChem CID 3715694) has the molecular formula C19H18F3N3O and a molecular weight of 361.37 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]propanamide.
| Compound Name | N-[(4-methylphenyl)methyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]propanamide |
|---|---|
| PubChem CID | 3715694 |
| Molecular Formula | C19H18F3N3O |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]propanamide |
| SMILES | Cc1ccc(CNC(=O)C(C)n2c(C(F)(F)F)nc3ccccc32)cc1 |
| InChI | InChI=1S/C19H18F3N3O/c1-12-7-9-14(10-8-12)11-23-17(26)13(2)25-16-6-4-3-5-15(16)24-18(25)19(20,21)22/h3-10,13H,11H2,1-2H3,(H,23,26) |
| InChIKey | JXIIANWUOISDLF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |