C11H14F3NO — CID 2765888
3-[benzyl(methyl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 2765888) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[benzyl(methyl)amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 2765888 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-[benzyl(methyl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CN(Cc1ccccc1)CC(O)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO/c1-15(8-10(16)11(12,13)14)7-9-5-3-2-4-6-9/h2-6,10,16H,7-8H2,1H3 |
| InChIKey | IVHKQRVWSJYCTF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |