C17H18F3NO — CID 24886302
3-(N-benzyl-4-methylanilino)-1,1,1-trifluoropropan-2-ol (PubChem CID 24886302) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-(N-benzyl-4-methylanilino)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(N-benzyl-4-methylanilino)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 24886302 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-(N-benzyl-4-methylanilino)-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1ccc(N(Cc2ccccc2)CC(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3NO/c1-13-7-9-15(10-8-13)21(12-16(22)17(18,19)20)11-14-5-3-2-4-6-14/h2-10,16,22H,11-12H2,1H3 |
| InChIKey | LUDGPCXGEMNUTA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|