C24H20F7NO4S — CID 24888197
3-[3-(benzenesulfonyl)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 24888197) has the molecular formula C24H20F7NO4S and a molecular weight of 551.48 g/mol. Its IUPAC name is 3-[3-(benzenesulfonyl)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-(benzenesulfonyl)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 24888197 |
| Molecular Formula | C24H20F7NO4S |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 3-[3-(benzenesulfonyl)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | O=S(=O)(c1ccccc1)c1cccc(N(Cc2cccc(OC(F)(F)C(F)F)c2)CC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F7NO4S/c25-22(26)24(30,31)36-18-8-4-6-16(12-18)14-32(15-21(33)23(27,28)29)17-7-5-11-20(13-17)37(34,35)19-9-2-1-3-10-19/h1-13,21-22,33H,14-15H2 |
| InChIKey | UQVDWCBDHJFSTF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|