C27H26F7NO3 — CID 11092814
1,1,1-trifluoro-3-[3-(4-propan-2-ylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol (PubChem CID 11092814) has the molecular formula C27H26F7NO3 and a molecular weight of 545.50 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[3-(4-propan-2-ylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[3-(4-propan-2-ylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 11092814 |
| Molecular Formula | C27H26F7NO3 |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 1,1,1-trifluoro-3-[3-(4-propan-2-ylphenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol |
| SMILES | CC(C)c1ccc(Oc2cccc(N(Cc3cccc(OC(F)(F)C(F)F)c3)CC(O)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H26F7NO3/c1-17(2)19-9-11-21(12-10-19)37-22-7-4-6-20(14-22)35(16-24(36)26(30,31)32)15-18-5-3-8-23(13-18)38-27(33,34)25(28)29/h3-14,17,24-25,36H,15-16H2,1-2H3 |
| InChIKey | AKRWANCWQLCUDH-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|