C18H15BrF7NO2 — CID 10863893
3-[3-bromo-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10863893) has the molecular formula C18H15BrF7NO2 and a molecular weight of 490.21 g/mol. Its IUPAC name is 3-[3-bromo-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-bromo-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10863893 |
| Molecular Formula | C18H15BrF7NO2 |
| Molecular Weight | 490.21 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 3-[3-bromo-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CN(Cc1cccc(OC(F)(F)C(F)F)c1)c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C18H15BrF7NO2/c19-12-4-2-5-13(8-12)27(10-15(28)17(22,23)24)9-11-3-1-6-14(7-11)29-18(25,26)16(20)21/h1-8,15-16,28H,9-10H2 |
| InChIKey | DIKGIVVDKGNDIB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.21 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|