C23H17F10N3O4 — CID 87443743
1,1,1-trifluoro-3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl-[4-[3-(trifluoromethoxy)phenoxy]pyrimidin-2-yl]amino]propan-2-ol (PubChem CID 87443743) has the molecular formula C23H17F10N3O4 and a molecular weight of 589.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl-[4-[3-(trifluoromethoxy)phenoxy]pyrimidin-2-yl]amino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl-[4-[3-(trifluoromethoxy)phenoxy]pyrimidin-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 87443743 |
| Molecular Formula | C23H17F10N3O4 |
| Molecular Weight | 589.39 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | 1,1,1-trifluoro-3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl-[4-[3-(trifluoromethoxy)phenoxy]pyrimidin-2-yl]amino]propan-2-ol |
| SMILES | OC(CN(Cc1cccc(OC(F)(F)C(F)F)c1)c1nccc(Oc2cccc(OC(F)(F)F)c2)n1)C(F)(F)F |
| InChI | InChI=1S/C23H17F10N3O4/c24-19(25)22(29,30)39-15-5-1-3-13(9-15)11-36(12-17(37)21(26,27)28)20-34-8-7-18(35-20)38-14-4-2-6-16(10-14)40-23(31,32)33/h1-10,17,19,37H,11-12H2 |
| InChIKey | GEBKZHCYHGYGTC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.39 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|