C24H18F10N2O3 — CID 10231673
(2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-[[3-(trifluoromethyl)-4-pyridinyl]oxy]anilino]propan-2-ol (PubChem CID 10231673) has the molecular formula C24H18F10N2O3 and a molecular weight of 572.40 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-[[3-(trifluoromethyl)-4-pyridinyl]oxy]anilino]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-[[3-(trifluoromethyl)-4-pyridinyl]oxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10231673 |
| Molecular Formula | C24H18F10N2O3 |
| Molecular Weight | 572.40 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-[[3-(trifluoromethyl)-4-pyridinyl]oxy]anilino]propan-2-ol |
| SMILES | O[C@H](CN(Cc1cccc(OC(F)(F)C(F)F)c1)c1cccc(Oc2ccncc2C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C24H18F10N2O3/c25-21(26)24(33,34)39-17-6-1-3-14(9-17)12-36(13-20(37)23(30,31)32)15-4-2-5-16(10-15)38-19-7-8-35-11-18(19)22(27,28)29/h1-11,20-21,37H,12-13H2/t20-/m1/s1 |
| InChIKey | LKTYGMXWNMMEON-HXUWFJFHSA-N |
| XLogP | 7.06 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.40 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|