C24H20F7NO4 — CID 10918359
4-[3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]phenoxy]phenol (PubChem CID 10918359) has the molecular formula C24H20F7NO4 and a molecular weight of 519.41 g/mol. Its IUPAC name is 4-[3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]phenoxy]phenol.
| Compound Name | 4-[3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]phenoxy]phenol |
|---|---|
| PubChem CID | 10918359 |
| Molecular Formula | C24H20F7NO4 |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 4-[3-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]phenoxy]phenol |
| SMILES | Oc1ccc(Oc2cccc(N(Cc3cccc(OC(F)(F)C(F)F)c3)CC(O)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H20F7NO4/c25-22(26)24(30,31)36-20-6-1-3-15(11-20)13-32(14-21(34)23(27,28)29)16-4-2-5-19(12-16)35-18-9-7-17(33)8-10-18/h1-12,21-22,33-34H,13-14H2 |
| InChIKey | YDDYUGZBVAFWEG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|