C29H26F3NO2 — CID 23506007
3-[N-[(3-benzylphenyl)methyl]-3-phenoxyanilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 23506007) has the molecular formula C29H26F3NO2 and a molecular weight of 477.53 g/mol. Its IUPAC name is 3-[N-[(3-benzylphenyl)methyl]-3-phenoxyanilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[N-[(3-benzylphenyl)methyl]-3-phenoxyanilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 23506007 |
| Molecular Formula | C29H26F3NO2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-[N-[(3-benzylphenyl)methyl]-3-phenoxyanilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CN(Cc1cccc(Cc2ccccc2)c1)c1cccc(Oc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C29H26F3NO2/c30-29(31,32)28(34)21-33(25-13-8-16-27(19-25)35-26-14-5-2-6-15-26)20-24-12-7-11-23(18-24)17-22-9-3-1-4-10-22/h1-16,18-19,28,34H,17,20-21H2 |
| InChIKey | RZCBXMDFWNVPPK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |