C27H23F10NO2 — CID 10210412
3-[3-(3-ethylphenoxy)-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10210412) has the molecular formula C27H23F10NO2 and a molecular weight of 583.47 g/mol. Its IUPAC name is 3-[3-(3-ethylphenoxy)-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-(3-ethylphenoxy)-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10210412 |
| Molecular Formula | C27H23F10NO2 |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 3-[3-(3-ethylphenoxy)-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1cccc(Oc2cccc(N(Cc3cccc(C(F)(F)C(F)(F)C(F)(F)F)c3)CC(O)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H23F10NO2/c1-2-17-6-4-10-21(13-17)40-22-11-5-9-20(14-22)38(16-23(39)25(30,31)32)15-18-7-3-8-19(12-18)24(28,29)26(33,34)27(35,36)37/h3-14,23,39H,2,15-16H2,1H3 |
| InChIKey | UPOGHWMKBBDHRU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|