C24H17Cl2F8NO2 — CID 10120801
(2R)-3-[3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10120801) has the molecular formula C24H17Cl2F8NO2 and a molecular weight of 574.30 g/mol. Its IUPAC name is (2R)-3-[3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-[3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10120801 |
| Molecular Formula | C24H17Cl2F8NO2 |
| Molecular Weight | 574.30 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | (2R)-3-[3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@H](CN(Cc1cccc(C(F)(F)C(F)(F)F)c1)c1cccc(Oc2cccc(Cl)c2Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C24H17Cl2F8NO2/c25-18-8-3-9-19(21(18)26)37-17-7-2-6-16(11-17)35(13-20(36)23(29,30)31)12-14-4-1-5-15(10-14)22(27,28)24(32,33)34/h1-11,20,36H,12-13H2/t20-/m1/s1 |
| InChIKey | YSKSNVMKBCLHTI-HXUWFJFHSA-N |
| XLogP | 8.37 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.30 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|