C28H21F8NO3 — CID 10303445
(2R)-1,1,1-trifluoro-3-[3-[2-(furan-2-yl)phenoxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]propan-2-ol (PubChem CID 10303445) has the molecular formula C28H21F8NO3 and a molecular weight of 571.46 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[3-[2-(furan-2-yl)phenoxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[3-[2-(furan-2-yl)phenoxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10303445 |
| Molecular Formula | C28H21F8NO3 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[3-[2-(furan-2-yl)phenoxy]-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]propan-2-ol |
| SMILES | O[C@H](CN(Cc1cccc(C(F)(F)C(F)(F)F)c1)c1cccc(Oc2ccccc2-c2ccco2)c1)C(F)(F)F |
| InChI | InChI=1S/C28H21F8NO3/c29-26(30,28(34,35)36)19-7-3-6-18(14-19)16-37(17-25(38)27(31,32)33)20-8-4-9-21(15-20)40-24-11-2-1-10-22(24)23-12-5-13-39-23/h1-15,25,38H,16-17H2/t25-/m1/s1 |
| InChIKey | AJSUNFJDAWAKQZ-RUZDIDTESA-N |
| XLogP | 8.32 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|