C30H29F3N2O4 — CID 23506091
1,1,1-trifluoro-3-[N-[[3-(furan-2-yl)-4-morpholin-4-ylphenyl]methyl]-3-phenoxyanilino]propan-2-ol (PubChem CID 23506091) has the molecular formula C30H29F3N2O4 and a molecular weight of 538.57 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[[3-(furan-2-yl)-4-morpholin-4-ylphenyl]methyl]-3-phenoxyanilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[[3-(furan-2-yl)-4-morpholin-4-ylphenyl]methyl]-3-phenoxyanilino]propan-2-ol |
|---|---|
| PubChem CID | 23506091 |
| Molecular Formula | C30H29F3N2O4 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[[3-(furan-2-yl)-4-morpholin-4-ylphenyl]methyl]-3-phenoxyanilino]propan-2-ol |
| SMILES | OC(CN(Cc1ccc(N2CCOCC2)c(-c2ccco2)c1)c1cccc(Oc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C30H29F3N2O4/c31-30(32,33)29(36)21-35(23-6-4-9-25(19-23)39-24-7-2-1-3-8-24)20-22-11-12-27(34-13-16-37-17-14-34)26(18-22)28-10-5-15-38-28/h1-12,15,18-19,29,36H,13-14,16-17,20-21H2 |
| InChIKey | LFEQRRUBHUAAAB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|