C31H31F3N2O3 — CID 71192684
1,1,1-trifluoro-3-[N-[[3-(furan-2-yl)-4-piperidin-1-ylphenyl]methyl]-3-phenoxyanilino]propan-2-ol (PubChem CID 71192684) has the molecular formula C31H31F3N2O3 and a molecular weight of 536.59 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[[3-(furan-2-yl)-4-piperidin-1-ylphenyl]methyl]-3-phenoxyanilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[[3-(furan-2-yl)-4-piperidin-1-ylphenyl]methyl]-3-phenoxyanilino]propan-2-ol |
|---|---|
| PubChem CID | 71192684 |
| Molecular Formula | C31H31F3N2O3 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[[3-(furan-2-yl)-4-piperidin-1-ylphenyl]methyl]-3-phenoxyanilino]propan-2-ol |
| SMILES | OC(CN(Cc1ccc(N2CCCCC2)c(-c2ccco2)c1)c1cccc(Oc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C31H31F3N2O3/c32-31(33,34)30(37)22-36(24-9-7-12-26(20-24)39-25-10-3-1-4-11-25)21-23-14-15-28(35-16-5-2-6-17-35)27(19-23)29-13-8-18-38-29/h1,3-4,7-15,18-20,30,37H,2,5-6,16-17,21-22H2 |
| InChIKey | YZGGAVBHBNKIIK-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|