C25H21F7INO2 — CID 59040117
(2S)-4,4-difluoro-4-iodo-1-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-phenoxyanilino]butan-2-ol (PubChem CID 59040117) has the molecular formula C25H21F7INO2 and a molecular weight of 627.34 g/mol. Its IUPAC name is (2S)-4,4-difluoro-4-iodo-1-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-phenoxyanilino]butan-2-ol.
| Compound Name | (2S)-4,4-difluoro-4-iodo-1-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-phenoxyanilino]butan-2-ol |
|---|---|
| PubChem CID | 59040117 |
| Molecular Formula | C25H21F7INO2 |
| Molecular Weight | 627.34 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | (2S)-4,4-difluoro-4-iodo-1-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-phenoxyanilino]butan-2-ol |
| SMILES | O[C@H](CN(Cc1cccc(C(F)(F)C(F)(F)F)c1)c1cccc(Oc2ccccc2)c1)CC(F)(F)I |
| InChI | InChI=1S/C25H21F7INO2/c26-23(27,33)14-20(35)16-34(15-17-6-4-7-18(12-17)24(28,29)25(30,31)32)19-8-5-11-22(13-19)36-21-9-2-1-3-10-21/h1-13,20,35H,14-16H2/t20-/m0/s1 |
| InChIKey | XMXRATOFOKCDCM-FQEVSTJZSA-N |
| XLogP | 7.92 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.34 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|